Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Regorafenib is a multi-target inhibitor for VEGFR1, VEGFR2, VEGFR3, PDGFRβ, Kit, RET and Raf-1 with IC50 of 13 nM/4.2 nM/46 nM, 22 nM, 7 nM, 1.5 nM and 2.5 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15218 |
|---|---|
| Formula | C21H17ClF4N4O4 |
| Molecular Weight | 500.83 |
| CAS Number | 1019206-88-2 |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)F.O |
| Synonyms | BAY 73-4506 monohydrate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (185.68 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.97 mL | 99.83 mL | 199.67 mL |
| 0.5 mM | 3.99 mL | 19.97 mL | 39.93 mL |
| 1 mM | 2 mL | 9.98 mL | 19.97 mL |
| 5 mM | 0.4 mL | 2 mL | 3.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
