Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Revefenacin is potent and selective muscarinic receptor antagonist in development for the treatment of COPD. |
|---|
| Catalog Num | A15986 |
|---|---|
| Formula | C35H43N5O4 |
| Molecular Weight | 597.76 |
| CAS Number | 864750-70-9 |
| SMILES | O=C(OC1CCN(CCN(C)C(C2=CC=C(CN3CCC(C(N)=O)CC3)C=C2)=O)CC1)NC4=CC=CC=C4C5=CC=CC=C5 |
| Synonyms | TD4208, GSK1160724 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (142.2 mM) | |
| Water | Insoluble | ||
| Ethanol | 85 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.73 mL | 83.65 mL | 167.29 mL |
| 0.5 mM | 3.35 mL | 16.73 mL | 33.46 mL |
| 1 mM | 1.67 mL | 8.36 mL | 16.73 mL |
| 5 mM | 0.33 mL | 1.67 mL | 3.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
