Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RG13022 is a tyrosine kinase inhibitor; inhibits the autophosphorylation reaction of the EGF receptor with an IC50 of 4 μM. |
|---|
| Catalog Num | A20455 |
|---|---|
| Formula | C16H14N2O2 |
| Molecular Weight | 266.29 |
| CAS Number | 136831-48-6 |
| SMILES | N#C/C(C1=CC=CN=C1)=C/C2=CC=C(OC)C(OC)=C2 |
| Synonyms | Tyrphostin RG13022 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (184.01 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.55 mL | 187.77 mL | 375.53 mL |
| 0.5 mM | 7.51 mL | 37.55 mL | 75.11 mL |
| 1 mM | 3.76 mL | 18.78 mL | 37.55 mL |
| 5 mM | 0.75 mL | 3.76 mL | 7.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
