Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Ribavirin (ICN-1229) is an antiviral agent against a broad spectrum of viruses including HCV, HIVl, and RSV. |
|---|
| Catalog Num | A10788 |
|---|---|
| Formula | C8H12N4O5 |
| Molecular Weight | 244.2 |
| CAS Number | 36791-04-5 |
| SMILES | C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (196.55 mM) | |
| Water | 48 mg/mL (196.55 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.95 mL | 204.75 mL | 409.5 mL |
| 0.5 mM | 8.19 mL | 40.95 mL | 81.9 mL |
| 1 mM | 4.1 mL | 20.48 mL | 40.95 mL |
| 5 mM | 0.82 mL | 4.1 mL | 8.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
