Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | RMC-4550 is a potent, selective and allosteric inhibitor of SHP2, with an IC50 of 0.583 nM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A18893 |
|---|---|
| Formula | C21H26Cl2N4O2 |
| Molecular Weight | 437.36 |
| CAS Number | 2172651-73-7 |
| SMILES | ClC1=C(Cl)C(C2=NC(CO)=C(N3CCC4(CO[C@@H](C)[C@H]4N)CC3)N=C2C)=CC=C1 |
| Synonyms | RMC4550, RMC-4550 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (208.06 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.86 mL | 114.32 mL | 228.64 mL |
| 0.5 mM | 4.57 mL | 22.86 mL | 45.73 mL |
| 1 mM | 2.29 mL | 11.43 mL | 22.86 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
