Loading distributor info...
| Description | RN-1734 is selective antagonist of the TRPV4 channel, completely antagonizes 4αPDD-mediated activation of TRPV4 with comparable, low micromolar IC50s for all three species (hTRPV4: 2.3 μM, mTRPV4: 5.9 μM, rTRPV4: 3.2 μM). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A20616 |
|---|---|
| Formula | C14H22Cl2N2O2S |
| Molecular Weight | 353.31 |
| CAS Number | 946387-07-1 |
| SMILES | O=S(C1=CC=C(Cl)C=C1Cl)(N(C(C)C)CCNC(C)C)=O |
| Synonyms | RN1734, RN 1734 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (178.31 mM) | |
| Water | Insoluble | ||
| Ethanol | 63 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.3 mL | 141.52 mL | 283.04 mL |
| 0.5 mM | 5.66 mL | 28.3 mL | 56.61 mL |
| 1 mM | 2.83 mL | 14.15 mL | 28.3 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.66 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
