Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RORγ modulator 1 is a retinoid-related orphan receptor gamma (RORy) modulator, extracted from patent WO/2015061515 A1, example 124. |
|---|
| Catalog Num | A16291 |
|---|---|
| Formula | C25H35NO5S |
| Molecular Weight | 461.61 |
| CAS Number | 1474110-21-8 |
| SMILES | CCC1=CC=C(C=C1)N(CC(C)C)S(=O)(=O)C2=CC(=C(C=C2)OCC3CCOCC3)CO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (184.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 85 mg/mL (184.14 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.66 mL | 108.32 mL | 216.63 mL |
| 0.5 mM | 4.33 mL | 21.66 mL | 43.33 mL |
| 1 mM | 2.17 mL | 10.83 mL | 21.66 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
