Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RU.521 (RU320521) is a potent and selective cyclic GMP-AMP synthase (cGAS) inhibitor and inhibits cGAS-mediated interferon upregulation. |
|---|
| Catalog Num | A18811 |
|---|---|
| Formula | C19H12Cl2N4O3 |
| Molecular Weight | 415.23 |
| CAS Number | 2262452-06-0 |
| SMILES | O=C1OC(C2=C(O)N(C3=NC4=CC=C(Cl)C(Cl)=C4N3)N=C2C)C5=C1C=CC=C5 |
| Synonyms | RU521, RU-521, RU-320521, RU 320521 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (192.66 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.08 mL | 120.42 mL | 240.83 mL |
| 0.5 mM | 4.82 mL | 24.08 mL | 48.17 mL |
| 1 mM | 2.41 mL | 12.04 mL | 24.08 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
