Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | (-)-(S)-Equol is a high affinity ligand for estrogen receptor β with a Ki of 0.73 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20465 |
|---|---|
| Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Number | 531-95-3 |
| SMILES | OC1=CC=C2C[C@@H](C3=CC=C(O)C=C3)COC2=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 41 mg/mL (169.23 mM) | |
| Water | Insoluble | ||
| Ethanol | 41 mg/mL (169.23 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.28 mL | 206.38 mL | 412.76 mL |
| 0.5 mM | 8.26 mL | 41.28 mL | 82.55 mL |
| 1 mM | 4.13 mL | 20.64 mL | 41.28 mL |
| 5 mM | 0.83 mL | 4.13 mL | 8.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
