Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SAH is an amino acid derivative and a modulartor in several metabolic pathways. It is an intermediate in the synthesis of cysteine and adenosine. SAH is an inhibitor for METTL3-METTL14 heterodimer complex (METTL3-14) with an IC50 of 0.9 ?M. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20742 |
|---|---|
| Formula | C14H20N6O5S |
| Molecular Weight | 384.41 |
| CAS Number | 979-92-0 |
| SMILES | N[C@@H](CCSC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=CN=C3N)O1)O)O)C(O)=O |
| Synonyms | SAH (S-Adenosylhomocysteine) |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (176.89 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.01 mL | 130.07 mL | 260.14 mL |
| 0.5 mM | 5.2 mL | 26.01 mL | 52.03 mL |
| 1 mM | 2.6 mL | 13.01 mL | 26.01 mL |
| 5 mM | 0.52 mL | 2.6 mL | 5.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
