Loading distributor info...
| Description | SC 560 is a COX-1 selective inhibitor, which can be used as a pharmacological tool to study the role of COX-1-derived PGs in inflammation and pain. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13023 |
|---|---|
| Formula | C17H12ClF3N2O |
| Molecular Weight | 352.74 |
| CAS Number | 188817-13-2 |
| SMILES | ClC1=CC=C(C=C1)C2=CC(C(F)(F)F)=NN2C(C=C3)=CC=C3OC |
| Synonyms | SC-560, SC560 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (172.93 mM) | |
| Water | Insoluble | ||
| Ethanol | 61 mg/mL (172.93 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.35 mL | 141.75 mL | 283.49 mL |
| 0.5 mM | 5.67 mL | 28.35 mL | 56.7 mL |
| 1 mM | 2.83 mL | 14.17 mL | 28.35 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.67 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
