Loading distributor info...
| Description | Scutellarin, a main active ingredient extracted from Erigeron breviscapus (Vant.) Hand-Mazz, has been wildly used to treat acute cerebral infarction and paralysis induced by cerebrovascular diseases. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12234 |
|---|---|
| Formula | C15H10O6 |
| Molecular Weight | 286.24 |
| CAS Number | 529-53-3 |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)O)O)O)O |
| Synonyms | 6-Hydroxyapigenin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (174.68 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.94 mL | 174.68 mL | 349.36 mL |
| 0.5 mM | 6.99 mL | 34.94 mL | 69.87 mL |
| 1 mM | 3.49 mL | 17.47 mL | 34.94 mL |
| 5 mM | 0.7 mL | 3.49 mL | 6.99 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
