Loading distributor info...
| Description | Short Neuropeptide F is an insect neurohormone that primarily targets neurohormonal pathways. It plays a crucial role in modulating locomotor activity and regulating circadian rhythms in insects. This peptide is valuable for research applications focused on neurobiology, entomology, and the study of circadian systems. |
|---|
| Catalog Num | B18663 |
|---|---|
| Formula | C110H170N26O35S |
| Molecular Weight | 2448.75 |
| CAS Number | 1202582-76-0 |
| Sequence | Ser-Asp-Pro-His-Leu-Ser-Ile-Leu-Ser-Lys-Pro-Met-Ser-Ala-Ile-Pro-Ser-Tyr-Lys-Phe-Asp-Asp |
| Sequence shortening | SDPHLSILSKPMSAIPSYKFDD |
| SMILES | C([C@@H](NC([C@H](CO)N)=O)CC(O)=O)(=O)N1[C@H](C(N[C@@H](CC2=CN=CN2)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N3[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N4[C@H](C(N[C@H](C(N[C@@H](CC5=CC=C(O)C=C5)C(N[C@H](C(N[C@@H](CC6=CC=CC=C6)C(N[C@H](C(N[C@@H](CC(O)=O)C(O)=O)=O)CC(O)=O)=O)=O)CCCCN)=O)=O)CO)=O)CCC4)[C@H](CC)C)=O)C)=O)CO)=O)CCSC)=O)CCC3)CCCCN)=O)CO)=O)CC(C)C)=O)[C@H](CC)C)=O)CO)=O)CC(C)C)=O)=O)CCC1 |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
