Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SKF-96365 hydrochloride is a non-selective TRP Channel blocker. |
|---|
| Catalog Num | A16706 |
|---|---|
| Formula | C22H27ClN2O3 |
| Molecular Weight | 402.91 |
| CAS Number | 130495-35-1 |
| SMILES | COC1=CC=C(CCCOC(C2=CC=C(OC)C=C2)CN3C=CN=C3)C=C1.[H]Cl |
| Synonyms | SKF96365, SKF 96365 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (173.73 mM) | |
| Water | 70 mg/mL (173.73 mM) | ||
| Ethanol | 70 mg/mL (173.73 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.82 mL | 124.1 mL | 248.19 mL |
| 0.5 mM | 4.96 mL | 24.82 mL | 49.64 mL |
| 1 mM | 2.48 mL | 12.41 mL | 24.82 mL |
| 5 mM | 0.5 mL | 2.48 mL | 4.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
