Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SKL2001 is an agonist of the Wnt/β-catenin pathway, with anti-cancer activity. SKL2001 stabilizes intracellular β-catenin via disruption of the Axin/β-catenin interaction. |
|---|
| Catalog Num | A16707 |
|---|---|
| Formula | C14H14N4O3 |
| Molecular Weight | 286.29 |
| CAS Number | 909089-13-0 |
| SMILES | O=C(C1=NOC(C2=CC=CO2)=C1)NCCCN3C=CN=C3 |
| Synonyms | SKL 2001, SKL-2001 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 50 mg/mL (174.64 mM) | |
| Water | Insoluble | ||
| Ethanol | 50 mg/mL (174.64 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 6 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.93 mL | 174.65 mL | 349.3 mL |
| 0.5 mM | 6.99 mL | 34.93 mL | 69.86 mL |
| 1 mM | 3.49 mL | 17.46 mL | 34.93 mL |
| 5 mM | 0.7 mL | 3.49 mL | 6.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
