Loading distributor info...
| Description | SMI-16a is a selective Pim kinase inhibitor with IC50 values of 0.15, 0.02 and 48 μM for Pim1, Pim2 and PC3 cells, respectively. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17157 |
|---|---|
| Formula | C13H13NO3S |
| Molecular Weight | 263.31 |
| CAS Number | 587852-28-6 |
| SMILES | O=C(NC/1=O)SC1=C\C2=CC=C(OCCC)C=C2 |
| Synonyms | SMI16a |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (197.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (15.19 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.98 mL | 189.89 mL | 379.78 mL |
| 0.5 mM | 7.6 mL | 37.98 mL | 75.96 mL |
| 1 mM | 3.8 mL | 18.99 mL | 37.98 mL |
| 5 mM | 0.76 mL | 3.8 mL | 7.6 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
