Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Sodium Sulfadiazine is a sodium salt form of sulfadiazine, an intermediate-acting bacteriostatic, synthetic sulfanilamide derivative. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16160 |
|---|---|
| Formula | C10H9N4NaO2S |
| Molecular Weight | 272.26 |
| CAS Number | 547-32-0 |
| SMILES | C1=CN=C(N=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Na+] |
| Synonyms | Sulfadiazin-natrium |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (29.38 mM) | |
| Water | 50 mg/mL (183.64 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.73 mL | 183.65 mL | 367.3 mL |
| 0.5 mM | 7.35 mL | 36.73 mL | 73.46 mL |
| 1 mM | 3.67 mL | 18.36 mL | 36.73 mL |
| 5 mM | 0.73 mL | 3.67 mL | 7.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
