Loading distributor info...
| Description | SOR-C13 is a high-affinity TRPV6 antagonist with an IC50 value of 14 nM. TRPV6 is a non-voltage gated calcium channel implicated in malignancy and poor prognosis in breast cancer. This compound exhibits significant anticancer activity, making it a valuable tool for research in cancer biology and therapeutic development. |
|---|
| Catalog Num | A68711 |
|---|---|
| Formula | C72H116N20O19 |
| Molecular Weight | 1565.81 |
| CAS Number | 1187852-48-7 |
| Sequence shortening | KEFLHPSKVDLPR |
| SMILES | C([C@H](CC1=CN=CN1)NC([C@@H](NC([C@H](CC2=CC=CC=C2)NC([C@@H](NC([C@H](CCCCN)N)=O)CCC(O)=O)=O)=O)CC(C)C)=O)(=O)N3[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N4[C@H](C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)CCC4)CC(C)C)=O)CC(O)=O)=O)[C@H](C)C)=O)CCCCN)=O)CO)=O)CCC3 |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
