Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Spiramycin is a clinically important 16-member macrolide antibiotic produced by Streptomyces ambofaciens. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16718 |
|---|---|
| Formula | C43H74N2O14 |
| Molecular Weight | 843.1 |
| CAS Number | 8025-81-8 |
| SMILES | O[C@H](C1)[C@H](OC)[C@@H](O[C@H]2[C@H](O)[C@@H](N(C)C)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@](O)(C)C3)[C@@H](C)O2)[C@@H](CC=O)C[C@@H](C)[C@@H](O[C@@H]4O[C@H](C)[C@@H](N(C)C)CC4)/C=C/C=C/C[C@@H](C)OC1=O |
| Synonyms | NSC 55926, Formacidine, Rovamycine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (102 mM) | |
| Water | Insoluble | ||
| Ethanol | 86 mg/mL (102 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.86 mL | 59.3 mL | 118.61 mL |
| 0.5 mM | 2.37 mL | 11.86 mL | 23.72 mL |
| 1 mM | 1.19 mL | 5.93 mL | 11.86 mL |
| 5 mM | 0.24 mL | 1.19 mL | 2.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
