Loading distributor info...
| Description | SQ22536 is an inhibitor of adenylyl cyclase with an IC50 of 1.4 uM. It can inhibit PGE1-stimulated increases in cAMP levels in intact human platelets. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16116 |
|---|---|
| Formula | C9H11N5O |
| Molecular Weight | 205.22 |
| CAS Number | 17318-31-9 |
| SMILES | NC(N=CN=C12)=C2N=CN1[C@@H]3OCCC3 |
| Synonyms | SQ 22536, SQ-22536 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (194.91 mM) | |
| Water | 40 mg/mL (194.91 mM) | ||
| Ethanol | 40 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.73 mL | 243.64 mL | 487.28 mL |
| 0.5 mM | 9.75 mL | 48.73 mL | 97.46 mL |
| 1 mM | 4.87 mL | 24.36 mL | 48.73 mL |
| 5 mM | 0.97 mL | 4.87 mL | 9.75 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
