Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SR0987, a SR1078 analog, is a RORγt agonist, with an EC50 of 800 nM. SR0987 increases IL17 expression while repressing the expression of PD-1. |
|---|
| Catalog Num | A20422 |
|---|---|
| Formula | C16H10ClF6NO2 |
| Molecular Weight | 397.7 |
| CAS Number | 303126-97-8 |
| SMILES | O=C(NC1=CC=C(C(C(F)(F)F)(O)C(F)(F)F)C=C1)C2=CC=CC=C2Cl |
| Synonyms | SR 0987, SR-0987 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (186.06 mM) | |
| Water | Insoluble | ||
| Ethanol | 37 mg/mL (93.03 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.14 mL | 125.72 mL | 251.45 mL |
| 0.5 mM | 5.03 mL | 25.14 mL | 50.29 mL |
| 1 mM | 2.51 mL | 12.57 mL | 25.14 mL |
| 5 mM | 0.5 mL | 2.51 mL | 5.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
