Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | SR1078 is an agonist of retinoic acid receptor-related orphan receptors (ROR) RORα/γ; increases transcription of RORα target genes; thought to increase p53 stability. |
|---|
| Catalog Num | A15245 |
|---|---|
| Formula | C17H10F9NO2 |
| Molecular Weight | 431.25 |
| CAS Number | 1246525-60-9 |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O)C(F)(F)F |
| Synonyms | SR 1078, SR-1078 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (190.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 82 mg/mL (190.14 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.19 mL | 115.94 mL | 231.88 mL |
| 0.5 mM | 4.64 mL | 23.19 mL | 46.38 mL |
| 1 mM | 2.32 mL | 11.59 mL | 23.19 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
