Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sulfacetamide has anti-inflammatory properties when used to treat blepharitis or conjunctivitis (in eye-drop solution). It is believed to work by limiting the presence of folic acid which bacteria need to survive. |
|---|
| Catalog Num | A17678 |
|---|---|
| Formula | C8H10N2O3S |
| Molecular Weight | 214.24 |
| CAS Number | 144-80-9 |
| SMILES | CC(NS(=O)(C1=CC=C(N)C=C1)=O)=O |
| Synonyms | NSC63871; NSC-63871; NSC 63871; Sulfacetamide; Region; Sebizon |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (172.7 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.68 mL | 233.38 mL | 466.77 mL |
| 0.5 mM | 9.34 mL | 46.68 mL | 93.35 mL |
| 1 mM | 4.67 mL | 23.34 mL | 46.68 mL |
| 5 mM | 0.93 mL | 4.67 mL | 9.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
