Loading distributor info...
| Description | T-kinin (Ile-Ser-bradykinin) is a peptide that specifically targets bradykinin pathways. It demonstrates significant biological activity in modulating inflammatory responses. T-kinin is primarily utilized in research related to the mechanisms of inflammation and related signaling pathways. |
|---|
| Catalog Num | A59141 |
|---|---|
| Formula | C59H89N17O14 |
| Molecular Weight | 1260.45 |
| CAS Number | 86030-63-9 |
| Sequence shortening | Ile-Ser-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg |
| SMILES | C(=O)([C@H]1N(C([C@@H](NC([C@@H](NC([C@H]([C@H](CC)C)N)=O)CO)=O)CCCNC(=N)N)=O)CCC1)N2[C@H](C(NCC(N[C@@H](CC3=CC=CC=C3)C(N[C@H](C(=O)N4[C@H](C(N[C@@H](CC5=CC=CC=C5)C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)=O)CCC4)CO)=O)=O)=O)CCC2 |
| Synonyms | Ile-Ser-bradykinin |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
