Loading distributor info...
| Description | Takinib is a selective TAK1 inhibitor that induces apoptosis following TNF-α stimulation in cell models of rheumatoid arthritis and metastatic breast cancer. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16960 |
|---|---|
| Formula | C18H18N4O2 |
| Molecular Weight | 322.36 |
| CAS Number | 1111556-37-6 |
| SMILES | O=C(C1=CC=CC(C(NC2=NC3=CC=CC=C3N2CCC)=O)=C1)N |
| Synonyms | EDHS-206, EDHS 206, EDHS206 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (189.22 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.02 mL | 155.11 mL | 310.21 mL |
| 0.5 mM | 6.2 mL | 31.02 mL | 62.04 mL |
| 1 mM | 3.1 mL | 15.51 mL | 31.02 mL |
| 5 mM | 0.62 mL | 3.1 mL | 6.2 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
