Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tapinarof (Benvitimod; WBI 1001; GSK2894512) is a natural aryl hydrocarbon receptor (AhR) agonist with an EC50 of 13 nM. |
|---|
| Catalog Num | A19285 |
|---|---|
| Formula | C17H18O2 |
| Molecular Weight | 254.32 |
| CAS Number | 79338-84-4 |
| SMILES | OC1=C(C(C)C)C(O)=CC(/C=C/C2=CC=CC=C2)=C1 |
| Synonyms | Benvitimod; WBI 1001, WBI1001, WBI-1001; GSK2894512, GSK 2894512, GSK-2894512 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (169.07 mM) | |
| Water | Insoluble | ||
| Ethanol | 43 mg/mL (169.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.32 mL | 196.6 mL | 393.21 mL |
| 0.5 mM | 7.86 mL | 39.32 mL | 78.64 mL |
| 1 mM | 3.93 mL | 19.66 mL | 39.32 mL |
| 5 mM | 0.79 mL | 3.93 mL | 7.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
