Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tazarotene is a prodrug and a member of the acetylenic class of retinoids. |
|---|
| Catalog Num | A10894 |
|---|---|
| Formula | C21H21NO2S |
| Molecular Weight | 351.5 |
| CAS Number | 118292-40-3 |
| SMILES | CCOC(=O)C1=CN=C(C=C1)C#CC2=CC3=C(C=C2)SCCC3(C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (25.61 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (25.61 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.45 mL | 142.25 mL | 284.5 mL |
| 0.5 mM | 5.69 mL | 28.45 mL | 56.9 mL |
| 1 mM | 2.84 mL | 14.22 mL | 28.45 mL |
| 5 mM | 0.57 mL | 2.84 mL | 5.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
