Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TFAP is a selective cyclooxygenase-1 (COX-1) inhibitor, with an IC50 of 0.8 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19468 |
|---|---|
| Formula | C13H10F3N3O |
| Molecular Weight | 281.23 |
| CAS Number | 1011244-68-0 |
| SMILES | O=C(NC1=NC=C(N)C=C1)C2=CC=C(C(F)(F)F)C=C2 |
| Synonyms | N-(5-Aminopyridin-2-yl)-4-(trifluoromethyl)benzamide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (195.56 mM) | |
| Water | Insoluble | ||
| Ethanol | 55 mg/mL (195.56 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.56 mL | 177.79 mL | 355.58 mL |
| 0.5 mM | 7.11 mL | 35.56 mL | 71.12 mL |
| 1 mM | 3.56 mL | 17.78 mL | 35.56 mL |
| 5 mM | 0.71 mL | 3.56 mL | 7.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
