Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tiotropium Bromide (BA679 BR) is a muscarinic acetylcholine receptor (mAChR) antagonist that blocks the binding of the acetylcholine ligand and subsequent opening of the ligand-gated ion channel. |
|---|
| Catalog Num | A10934 |
|---|---|
| Formula | C19H22BrNO4S2 |
| Molecular Weight | 472.42 |
| CAS Number | 136310-93-5 |
| SMILES | O=C(C(C1=CC=CS1)(O)C2=CC=CS2)O[C@H]3C[C@H]([N+]4(C)C)[C@@H]5O[C@@H]5[C@H]4C3.[Br-] |
| Synonyms | BA679 BR, BA 679, BA-679 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (16.31 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.17 mL | 105.84 mL | 211.68 mL |
| 0.5 mM | 4.23 mL | 21.17 mL | 42.34 mL |
| 1 mM | 2.12 mL | 10.58 mL | 21.17 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.23 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
