Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Tipifarnib (Zarnestra) is a farnesyltransferase inhibitor that inhibits the Ras kinase in a post translational modification step before the kinase pathway becomes hyperactive. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A10935 |
|---|---|
| Formula | C27H22Cl2N4O |
| Molecular Weight | 489.4 |
| CAS Number | 192185-72-1 |
| SMILES | CN1C=NC=C1[C@@](C2=CC=C(C=C2)Cl)(C3=CC4=C(C=C3)N(C(=O)C=C4C5=CC(=CC=C5)Cl)C)N |
| Synonyms | IND 58359, R115777 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 14 mg/mL (28.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 15% Captisol+citrate vehicle | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.43 mL | 102.17 mL | 204.33 mL |
| 0.5 mM | 4.09 mL | 20.43 mL | 40.87 mL |
| 1 mM | 2.04 mL | 10.22 mL | 20.43 mL |
| 5 mM | 0.41 mL | 2.04 mL | 4.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
