Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TMP 269 is a potent, selective class IIa HDAC inhibitor with IC50 of 157 nM, 97 nM, 43 nM and 23 nM for HDAC4, HDAC5, HDAC7 and HDAC9, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14128 |
|---|---|
| Formula | C25H21F3N4O3S |
| Molecular Weight | 514.52 |
| CAS Number | 1314890-29-3 |
| SMILES | O=C(c1cccc(c1)c1noc(n1)C(F)(F)F)NCC1(CCOCC1)c1scc(n1)c1ccccc1 |
| Synonyms | TMP-269,TMP269 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (172.97 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (3.88 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.44 mL | 97.18 mL | 194.36 mL |
| 0.5 mM | 3.89 mL | 19.44 mL | 38.87 mL |
| 1 mM | 1.94 mL | 9.72 mL | 19.44 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
