Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TPI-1, also known as Tyrosine Phosphatase Inhibitor 1, is a SHP-1 inhibitor; inhibits recombinant SHP-1 with an IC50 of 40 nM. |
|---|
| Catalog Num | A20423 |
|---|---|
| Formula | C12H6Cl2O2 |
| Molecular Weight | 253.08 |
| CAS Number | 79756-69-7 |
| SMILES | ClC1=CC(C2=CC(C=CC2=O)=O)=C(Cl)C=C1 |
| Synonyms | TPI1, TPI 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (185.71 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (35.56 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.51 mL | 197.57 mL | 395.13 mL |
| 0.5 mM | 7.9 mL | 39.51 mL | 79.03 mL |
| 1 mM | 3.95 mL | 19.76 mL | 39.51 mL |
| 5 mM | 0.79 mL | 3.95 mL | 7.9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
