Loading distributor info...
| Description | Tranilast is an inhibitor of the production of interleukin-6 in endothelial cells. It acts by reducing collagen synthesis in fibroblasts and inhibiting growth of neurofibroma cells. |
|---|
| Catalog Num | A17790 |
|---|---|
| Formula | C18H17NO5 |
| Molecular Weight | 327.33 |
| CAS Number | 70806-55-2 |
| SMILES | O=C(O)C1=CC=CC=C1NC(/C=C/C2=CC=C(OC)C(OC)=C2)=O |
| Synonyms | Tranilast; Rizaben; SB-252218; SB 252218; SB252218; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (189.41 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (12.22 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.55 mL | 152.75 mL | 305.5 mL |
| 0.5 mM | 6.11 mL | 30.55 mL | 61.1 mL |
| 1 mM | 3.06 mL | 15.28 mL | 30.55 mL |
| 5 mM | 0.61 mL | 3.06 mL | 6.11 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
