Loading distributor info...
| Description | TVB-3664 is an orally available, reversible, potent, selective and highly bioavailable fatty acid synthase (FASN) inhibitor, with IC50 values of 18 nM and 12 nM for human and mouse cell palmitate synthesis, respectively. TVB-3664 significantly reduces tubulin palmitoylation and mRNA expression. |
|---|
| Catalog Num | A18829 |
|---|---|
| Formula | C25H23F3N4O2 |
| Molecular Weight | 468.47 |
| CAS Number | 2097262-58-1 |
| SMILES | CC1=C(C=C(C(C)=C1)C(N2CC(C2)C3=CC=C(C=C3)C#N)=O)C4=C(N=C(N4)C(F)(F)F)COC |
| Synonyms | TVB-3664; TVB 3664; TVB3664. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (183.57 mM) | |
| Water | Insoluble | ||
| Ethanol | 46 mg/mL (98.19 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.35 mL | 106.73 mL | 213.46 mL |
| 0.5 mM | 4.27 mL | 21.35 mL | 42.69 mL |
| 1 mM | 2.13 mL | 10.67 mL | 21.35 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.27 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
