Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | URB602 is a selective inhibitor of monoglycerol lipase (MGL), exhibiting an IC50 of 28 μM for the rat brain enzyme. |
|---|
| Catalog Num | A16359 |
|---|---|
| Formula | C19H21NO2 |
| Molecular Weight | 295.38 |
| CAS Number | 565460-15-3 |
| SMILES | O=C(OC1CCCCC1)NC2=CC(C3=CC=CC=C3)=CC=C2 |
| Synonyms | URB 602, URB-602 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (172.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 51 mg/mL (172.66 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.85 mL | 169.27 mL | 338.55 mL |
| 0.5 mM | 6.77 mL | 33.85 mL | 67.71 mL |
| 1 mM | 3.39 mL | 16.93 mL | 33.85 mL |
| 5 mM | 0.68 mL | 3.39 mL | 6.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
