Loading distributor info...
| Description | Uridine 5'-monophosphate (5'-?Uridylic acid), a monophosphate form of UTP, can be acquired either from a de novo pathway or degradation products of nucleotides and nucleic acids in vivo and is a major nucleotide analogue in mammalian milk. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17880 |
|---|---|
| Formula | C9H13N2O9P |
| Molecular Weight | 324.18 |
| CAS Number | 58-97-9 |
| SMILES | O=P(O)(OC[C@@H]1[C@H]([C@H]([C@H](N2C(NC(C=C2)=O)=O)O1)O)O)O |
| Synonyms | 5'-Uridylic acid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (185.08 mM) | |
| Ethanol | <1 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.85 mL | 154.24 mL | 308.47 mL |
| 0.5 mM | 6.17 mL | 30.85 mL | 61.69 mL |
| 1 mM | 3.08 mL | 15.42 mL | 30.85 mL |
| 5 mM | 0.62 mL | 3.08 mL | 6.17 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
