Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Vidofludimus is a novel orally active and potent DHODH inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12997 |
|---|---|
| Formula | C20H18FNO4 |
| Molecular Weight | 355.36 |
| CAS Number | 717824-30-1 |
| SMILES | COC1=CC=CC(=C1)C2=CC(=C(C=C2)NC(=O)C3=C(CCC3)C(=O)O)F |
| Synonyms | 4SC 101, 4SC101, 4SC-101, SC12267, SC-12267, SC 12267 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 96 mg/mL (270.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 1 mg/mL (2.81 mM) | ||
| In vivo | Suspended in water | 19 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.14 mL | 140.7 mL | 281.4 mL |
| 0.5 mM | 5.63 mL | 28.14 mL | 56.28 mL |
| 1 mM | 2.81 mL | 14.07 mL | 28.14 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
