Loading distributor info...
| Description | VIRIP, derived from human α1-AT(353-372), functions as an inhibitor of HIV-1 by targeting the gp41 fusion peptide. It prevents the entry of HIV-1 into host cells, thereby disrupting the viral lifecycle. This reagent is applicable in virology research and studies focused on HIV-1 entry mechanisms. |
|---|
| Catalog Num | A51418 |
|---|---|
| Formula | C112H171N23O27S |
| Molecular Weight | 2303.76 |
| CAS Number | 339332-64-8 |
| Sequence | Leu-Glu-Ala-Ile-Pro-Met-Ser-Ile-Pro-Pro-Glu-Val-Lys-Phe-Asn-Lys-Pro-Phe-Val-Phe |
| Sequence shortening | LEAIPMSIPPEVKFNKPFVF |
| SMILES | C(=O)([C@H]1N(C([C@@H](NC([C@@H](NC([C@@H](NC(=O)[C@H]2N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC(C)C)N)=O)CCC(O)=O)=O)C)=O)[C@H](CC)C)=O)CCC2)CCSC)=O)CO)=O)[C@H](CC)C)=O)CCC1)N3[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC4=CC=CC=C4)C(N[C@H](C(N[C@H](C(=O)N5[C@H](C(N[C@@H](CC6=CC=CC=C6)C(N[C@H](C(N[C@@H](CC7=CC=CC=C7)C(O)=O)=O)[C@H](C)C)=O)=O)CCC5)CCCCN)=O)CC(N)=O)=O)=O)CCCCN)=O)[C@H](C)C)=O)CCC(O)=O)=O)CCC3 |
| Synonyms | human α1-AT(353-372) |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
