Loading distributor info...
| Description | Vitexin demonstrates antioxidant activity in a DPPH bleaching assay (IC50 = 24.2uM) and also inhibits the activity of the carbohydrate-hydrolyzing enzyme α-glucosidase (IC50 = 244 uM). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12135 |
|---|---|
| Formula | C21H20O10 |
| Molecular Weight | 432.4 |
| CAS Number | 3681-93-4 |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Synonyms | Orientoside |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (97.14 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.13 mL | 115.63 mL | 231.27 mL |
| 0.5 mM | 4.63 mL | 23.13 mL | 46.25 mL |
| 1 mM | 2.31 mL | 11.56 mL | 23.13 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.63 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
