Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Y-33075 dihydrochloride is a selective ROCK inhibitor with an IC50 of 3.6 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11611 |
|---|---|
| Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 |
| CAS Number | 173897-44-4 |
| SMILES | O=C(C1=CC=C([C@@H](C)N)C=C1)NC2=C3C(NC=C3)=NC=C2.[H]Cl.[H]Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (169.85 mM) | |
| Water | 60 mg/mL (169.85 mM) | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.31 mL | 141.54 mL | 283.09 mL |
| 0.5 mM | 5.66 mL | 28.31 mL | 56.62 mL |
| 1 mM | 2.83 mL | 14.15 mL | 28.31 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
