Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | YHO-13177 is a potent and specific inhibitor of breast cancer resistance protein (BCRP/ABCG2). |
|---|
| Catalog Num | A17127 |
|---|---|
| Formula | C20H22N2O3S |
| Molecular Weight | 370.46 |
| CAS Number | 912287-56-0 |
| SMILES | N#C/C(C1=CC=C(OC)C(OC)=C1)=C\C2=CC=C(N3CCC(O)CC3)S2 |
| Synonyms | YHO13177, YHO 13177 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (188.94 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.99 mL | 134.97 mL | 269.93 mL |
| 0.5 mM | 5.4 mL | 26.99 mL | 53.99 mL |
| 1 mM | 2.7 mL | 13.5 mL | 26.99 mL |
| 5 mM | 0.54 mL | 2.7 mL | 5.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
