Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Zileuton is a potent and selective inhibitor of 5-lipoxygenase with antiasthmatic properties. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11007 |
|---|---|
| Formula | C11H12N2O2S |
| Molecular Weight | 236.29 |
| CAS Number | 111406-87-2 |
| SMILES | CC(N(O)C(N)=O)C1=CC2=CC=CC=C2S1 |
| Synonyms | A 64077; Abbott 64077, A64077, A-64077 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (169.28 mM) | |
| Water | Insoluble | ||
| Ethanol | 40 mg/mL (169.28 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.32 mL | 211.6 mL | 423.21 mL |
| 0.5 mM | 8.46 mL | 42.32 mL | 84.64 mL |
| 1 mM | 4.23 mL | 21.16 mL | 42.32 mL |
| 5 mM | 0.85 mL | 4.23 mL | 8.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
