Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ZT-12-037-01 is a potent, selective, ATP-competitive STK19 inhibitor. ZT-12-037-01 effectively blocks oncogenic NRAS-driven melanocyte malignant transformation and melanoma growth in vitro and in vivo. |
|---|
| Catalog Num | A18395 |
|---|---|
| Formula | C21H31N5O2 |
| Molecular Weight | 385.51 |
| CAS Number | 2328073-61-4 |
| SMILES | COC1=CC2=NC(NC3CC3)=NC(NC4CCN(C(C)C)CC4)=C2C=C1OC |
| Synonyms | ZT-12-037-01; ZT-12-03701; ZT-12-037 01; ZT-12037-01; ZT-1203701; ZT-12037 01; ZT-1203701; ZT-1203701; ZT-1203701; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (103.76 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (7.78 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.94 mL | 129.7 mL | 259.4 mL |
| 0.5 mM | 5.19 mL | 25.94 mL | 51.88 mL |
| 1 mM | 2.59 mL | 12.97 mL | 25.94 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
