Loading distributor info...
| Description | BG45 is an HDAC class I inhibitor with selectivity for HDAC3 (IC50 = 289 nM). It inhibits HDAC1, HDAC2, and HDAC6 with greatly reduced potency (IC50s = 2, 2.2, and >20 μM, respectively). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11361 |
|---|---|
| Formula | C11H10N4O |
| Molecular Weight | 214.22 |
| CAS Number | 926259-99-6 |
| SMILES | NC1=CC=CC=C1/N=C(O)/C2=CN=CC=N2 |
| Synonyms | BG 45, BG-45 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (186.72 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (9.33 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.68 mL | 233.4 mL | 466.81 mL |
| 0.5 mM | 9.34 mL | 46.68 mL | 93.36 mL |
| 1 mM | 4.67 mL | 23.34 mL | 46.68 mL |
| 5 mM | 0.93 mL | 4.67 mL | 9.34 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
