Loading distributor info...
| Description | Ibuprofen is a nonsteroidal anti-inflammatory drug (NSAID) targeting COX-1 with an IC50 of 13 μM. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10461 |
|---|---|
| Formula | C13H18O2 |
| Molecular Weight | 206.3 |
| CAS Number | 15687-27-1 |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O |
| Synonyms | Genpril, Brufen, Nurofen, Motrin, Ibren, Ibuprohm |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 40 mg/mL (193.9 mM) | |
| Water | Insoluble | ||
| Ethanol | 40 mg/mL (193.9 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 19 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.47 mL | 242.37 mL | 484.73 mL |
| 0.5 mM | 9.69 mL | 48.47 mL | 96.95 mL |
| 1 mM | 4.85 mL | 24.24 mL | 48.47 mL |
| 5 mM | 0.97 mL | 4.85 mL | 9.69 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
