Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Androsterone is a steroid hormone produced in the body from 5α-reduced metabolites of dehydroepiandrosterone. It is the major androgen excreted in urine as a metabolite of testosterone and is used as the international reference standard for androgenic activity. |
|---|
| Catalog Num | A17043 |
|---|---|
| Formula | C19H30O2 |
| Molecular Weight | 290.44 |
| CAS Number | 53-41-8 |
| SMILES | O=C1CC[C@@]2([H])[C@]3([H])CC[C@@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@@]21C |
| Synonyms | NSC 9898, NSC-9898, NSC9898, Androkinin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 26 mg/mL (89.51 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.43 mL | 172.15 mL | 344.31 mL |
| 0.5 mM | 6.89 mL | 34.43 mL | 68.86 mL |
| 1 mM | 3.44 mL | 17.22 mL | 34.43 mL |
| 5 mM | 0.69 mL | 3.44 mL | 6.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
