Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Autophinib is a novel potent autophagy inhibitor, inhibiting autophagy induced by starvation or Rapamycin by targeting the lipid kinase VPS34. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17241 |
|---|---|
| Formula | C14H11ClN6O3 |
| Molecular Weight | 346.731 |
| CAS Number | 1644443-47-9 |
| SMILES | O=[N+](C1=CC=C(OC2=NC(Cl)=CC(NC3=NNC(C)=C3)=N2)C=C1)[O-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (181.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.84 mL | 144.2 mL | 288.41 mL |
| 0.5 mM | 5.77 mL | 28.84 mL | 57.68 mL |
| 1 mM | 2.88 mL | 14.42 mL | 28.84 mL |
| 5 mM | 0.58 mL | 2.88 mL | 5.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
