Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Avatrombopag is a novel orally-active thrombopoietin (TPO) receptor agonist. |
|---|
| Catalog Num | A14087 |
|---|---|
| Formula | C29H34Cl2N6O3S2 |
| Molecular Weight | 649.65 |
| CAS Number | 570406-98-3 |
| SMILES | O=C(C1CCN(C2=NC=C(C(NC3=NC(C4=CC(Cl)=CS4)=C(N5CCN(C6CCCCC6)CC5)S3)=O)C=C2Cl)CC1)O |
| Synonyms | AKR-501, YM477, E5501, AS 1670542 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (26.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.39 mL | 76.96 mL | 153.93 mL |
| 0.5 mM | 3.08 mL | 15.39 mL | 30.79 mL |
| 1 mM | 1.54 mL | 7.7 mL | 15.39 mL |
| 5 mM | 0.31 mL | 1.54 mL | 3.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
