Loading distributor info...
| Description | Bisoprolol is a drug belonging to the group of beta blockers, a class of drugs used primarily in cardiovascular diseases. More specifically, it is a selective type β1 adrenergic receptor blocker. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10149 |
|---|---|
| Formula | C18H31NO4.1/2C4H4O4 |
| Molecular Weight | 383.48 |
| CAS Number | 104344-23-2 |
| SMILES | OC(CNC(C)C)COC1=CC=C(COCCOC(C)C)C=C1.OC(/C=C/C(O)=O)=O |
| Synonyms | Zebeta |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (172.13 mM) | |
| Water | 76 mg/mL (172.13 mM) | ||
| Ethanol | 76 mg/mL (172.13 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.08 mL | 130.38 mL | 260.77 mL |
| 0.5 mM | 5.22 mL | 26.08 mL | 52.15 mL |
| 1 mM | 2.61 mL | 13.04 mL | 26.08 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.22 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
