Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Boceprevir is a protease inhibitor used as a treatment for hepatitis C genotype 1. |
|---|
| Catalog Num | A11332 |
|---|---|
| Formula | C27H45N5O5 |
| Molecular Weight | 519.7 |
| CAS Number | 394730-60-0 |
| SMILES | CC1([C@@H]2[C@H]1[C@H](N(C2)C(=O)[C@H](C(C)(C)C)NC(=O)NC(C)(C)C)C(=O)NC(CC3CCC3)C(=O)C(=O)N)C |
| Synonyms | EBP 520, SCH 503034 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (173.18 mM) | |
| Water | Insoluble | ||
| Ethanol | 90 mg/mL (173.18 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.24 mL | 96.21 mL | 192.42 mL |
| 0.5 mM | 3.85 mL | 19.24 mL | 38.48 mL |
| 1 mM | 1.92 mL | 9.62 mL | 19.24 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
